C19H32FN — CID 65448790
1-(4-fluoro-3,5-dimethylphenyl)-N-methyldecan-1-amine (PubChem CID 65448790) has the molecular formula C19H32FN and a molecular weight of 293.47 g/mol. Its IUPAC name is 1-(4-fluoro-3,5-dimethylphenyl)-N-methyldecan-1-amine.
| Compound Name | 1-(4-fluoro-3,5-dimethylphenyl)-N-methyldecan-1-amine |
|---|---|
| PubChem CID | 65448790 |
| Molecular Formula | C19H32FN |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 1-(4-fluoro-3,5-dimethylphenyl)-N-methyldecan-1-amine |
| SMILES | CCCCCCCCCC(NC)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C19H32FN/c1-5-6-7-8-9-10-11-12-18(21-4)17-13-15(2)19(20)16(3)14-17/h13-14,18,21H,5-12H2,1-4H3 |
| InChIKey | PKOIKVXBRVTFDW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|