C15H19KN2O6 — CID 174663489
potassium;(2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate;hydride (PubChem CID 174663489) has the molecular formula C15H19KN2O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is potassium;(2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate;hydride.
| Compound Name | potassium;(2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate;hydride |
|---|---|
| PubChem CID | 174663489 |
| Molecular Formula | C15H19KN2O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | potassium;(2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate;hydride |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)C=C(C)C.[H-].[K+] |
| InChI | InChI=1S/C15H18N2O6.K.H/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3;;/h6-8,10H,5H2,1-4H3;;/q;+1;-1 |
| InChIKey | BLEGQZGTTMOUPY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|