C20H24N2O5 — CID 57252853
2,6-di(butan-2-yl)-4-(2,4-dinitrophenyl)phenol (PubChem CID 57252853) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2,6-di(butan-2-yl)-4-(2,4-dinitrophenyl)phenol.
| Compound Name | 2,6-di(butan-2-yl)-4-(2,4-dinitrophenyl)phenol |
|---|---|
| PubChem CID | 57252853 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2,6-di(butan-2-yl)-4-(2,4-dinitrophenyl)phenol |
| SMILES | CCC(C)c1cc(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(C(C)CC)c1O |
| InChI | InChI=1S/C20H24N2O5/c1-5-12(3)17-9-14(10-18(20(17)23)13(4)6-2)16-8-7-15(21(24)25)11-19(16)22(26)27/h7-13,23H,5-6H2,1-4H3 |
| InChIKey | CPJMOONSIARVDO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|