C20H25NO3 — CID 56975046
2,6-di(butan-2-yl)-4-(2-nitrophenyl)phenol (PubChem CID 56975046) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2,6-di(butan-2-yl)-4-(2-nitrophenyl)phenol.
| Compound Name | 2,6-di(butan-2-yl)-4-(2-nitrophenyl)phenol |
|---|---|
| PubChem CID | 56975046 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2,6-di(butan-2-yl)-4-(2-nitrophenyl)phenol |
| SMILES | CCC(C)c1cc(-c2ccccc2[N+](=O)[O-])cc(C(C)CC)c1O |
| InChI | InChI=1S/C20H25NO3/c1-5-13(3)17-11-15(12-18(20(17)22)14(4)6-2)16-9-7-8-10-19(16)21(23)24/h7-14,22H,5-6H2,1-4H3 |
| InChIKey | GRVCOFUCUQWZGF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|