C17H17N2NaO7 — CID 159722528
sodium;2-butan-2-yl-4,6-dinitrophenol;benzoate (PubChem CID 159722528) has the molecular formula C17H17N2NaO7 and a molecular weight of 384.32 g/mol. Its IUPAC name is sodium;2-butan-2-yl-4,6-dinitrophenol;benzoate.
| Compound Name | sodium;2-butan-2-yl-4,6-dinitrophenol;benzoate |
|---|---|
| PubChem CID | 159722528 |
| Molecular Formula | C17H17N2NaO7 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | sodium;2-butan-2-yl-4,6-dinitrophenol;benzoate |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O.O=C([O-])c1ccccc1.[Na+] |
| InChI | InChI=1S/C10H12N2O5.C7H6O2.Na/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17;8-7(9)6-4-2-1-3-5-6;/h4-6,13H,3H2,1-2H3;1-5H,(H,8,9);/q;;+1/p-1 |
| InChIKey | YCNUBXCPZMIAHA-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|