C22H24N2O3 — CID 57158062
4-[4-(2-nitrophenyl)-1H-pyrrol-2-yl]-2,6-dipropylphenol (PubChem CID 57158062) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-[4-(2-nitrophenyl)-1H-pyrrol-2-yl]-2,6-dipropylphenol.
| Compound Name | 4-[4-(2-nitrophenyl)-1H-pyrrol-2-yl]-2,6-dipropylphenol |
|---|---|
| PubChem CID | 57158062 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-[4-(2-nitrophenyl)-1H-pyrrol-2-yl]-2,6-dipropylphenol |
| SMILES | CCCc1cc(-c2cc(-c3ccccc3[N+](=O)[O-])c[nH]2)cc(CCC)c1O |
| InChI | InChI=1S/C22H24N2O3/c1-3-7-15-11-17(12-16(8-4-2)22(15)25)20-13-18(14-23-20)19-9-5-6-10-21(19)24(26)27/h5-6,9-14,23,25H,3-4,7-8H2,1-2H3 |
| InChIKey | XZZUGKUWESTHRY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|