C28H37N5O10 — CID 158867482
(2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate;N-butyl-N-ethyl-4-methyl-2,6-dinitroaniline (PubChem CID 158867482) has the molecular formula C28H37N5O10 and a molecular weight of 603.63 g/mol. Its IUPAC name is (2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate;N-butyl-N-ethyl-4-methyl-2,6-dinitroaniline.
| Compound Name | (2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate;N-butyl-N-ethyl-4-methyl-2,6-dinitroaniline |
|---|---|
| PubChem CID | 158867482 |
| Molecular Formula | C28H37N5O10 |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | (2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate;N-butyl-N-ethyl-4-methyl-2,6-dinitroaniline |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)C=C(C)C.CCCCN(CC)c1c([N+](=O)[O-])cc(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N2O6.C13H19N3O4/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3;1-4-6-7-14(5-2)13-11(15(17)18)8-10(3)9-12(13)16(19)20/h6-8,10H,5H2,1-4H3;8-9H,4-7H2,1-3H3 |
| InChIKey | JBKPUYAGFOPEDA-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 202.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|