C29H36N4O13 — CID 160544072
2-(2-butan-2-yl-4,6-dinitrophenyl)-3-methylbut-2-enoic acid;2-(2-butan-2-yl-4,6-dinitrophenyl)propan-2-yl hydrogen carbonate (PubChem CID 160544072) has the molecular formula C29H36N4O13 and a molecular weight of 648.62 g/mol. Its IUPAC name is 2-(2-butan-2-yl-4,6-dinitrophenyl)-3-methylbut-2-enoic acid;2-(2-butan-2-yl-4,6-dinitrophenyl)propan-2-yl hydrogen carbonate.
| Compound Name | 2-(2-butan-2-yl-4,6-dinitrophenyl)-3-methylbut-2-enoic acid;2-(2-butan-2-yl-4,6-dinitrophenyl)propan-2-yl hydrogen carbonate |
|---|---|
| PubChem CID | 160544072 |
| Molecular Formula | C29H36N4O13 |
| Molecular Weight | 648.62 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | 2-(2-butan-2-yl-4,6-dinitrophenyl)-3-methylbut-2-enoic acid;2-(2-butan-2-yl-4,6-dinitrophenyl)propan-2-yl hydrogen carbonate |
| SMILES | CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C(C(=O)O)=C(C)C.CCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1C(C)(C)OC(=O)O |
| InChI | InChI=1S/C15H18N2O6.C14H18N2O7/c1-5-9(4)11-6-10(16(20)21)7-12(17(22)23)14(11)13(8(2)3)15(18)19;1-5-8(2)10-6-9(15(19)20)7-11(16(21)22)12(10)14(3,4)23-13(17)18/h6-7,9H,5H2,1-4H3,(H,18,19);6-8H,5H2,1-4H3,(H,17,18) |
| InChIKey | QXEKQLAAYOPRQH-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 256.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.62 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|