C42H48N2O8 — CID 139145272
4-[[4-[bis(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol;nitromethane (PubChem CID 139145272) has the molecular formula C42H48N2O8 and a molecular weight of 708.85 g/mol. Its IUPAC name is 4-[[4-[bis(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol;nitromethane.
| Compound Name | 4-[[4-[bis(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol;nitromethane |
|---|---|
| PubChem CID | 139145272 |
| Molecular Formula | C42H48N2O8 |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | 4-[[4-[bis(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol;nitromethane |
| SMILES | C[N+](=O)[O-].C[N+](=O)[O-].Cc1cc(C(c2ccc(C(c3cc(C)c(O)c(C)c3)c3cc(C)c(O)c(C)c3)cc2)c2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C40H42O4.2CH3NO2/c1-21-13-31(14-22(2)37(21)41)35(32-15-23(3)38(42)24(4)16-32)29-9-11-30(12-10-29)36(33-17-25(5)39(43)26(6)18-33)34-19-27(7)40(44)28(8)20-34;2*1-2(3)4/h9-20,35-36,41-44H,1-8H3;2*1H3 |
| InChIKey | RBGOHPIAIRIJTM-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|