C25H28O2 — CID 110175378
4-[(2,5-dimethylphenyl)-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol (PubChem CID 110175378) has the molecular formula C25H28O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol.
| Compound Name | 4-[(2,5-dimethylphenyl)-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 110175378 |
| Molecular Formula | C25H28O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)-(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
| SMILES | Cc1ccc(C)c(C(c2cc(C)c(O)c(C)c2)c2cc(C)c(O)c(C)c2)c1 |
| InChI | InChI=1S/C25H28O2/c1-14-7-8-15(2)22(9-14)23(20-10-16(3)24(26)17(4)11-20)21-12-18(5)25(27)19(6)13-21/h7-13,23,26-27H,1-6H3 |
| InChIKey | PCFCFPHHTVIMDA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|