C26H30 — CID 59749663
1,2,3-trimethyl-5-[(4-methylphenyl)-(3,4,5-trimethylphenyl)methyl]benzene (PubChem CID 59749663) has the molecular formula C26H30 and a molecular weight of 342.53 g/mol. Its IUPAC name is 1,2,3-trimethyl-5-[(4-methylphenyl)-(3,4,5-trimethylphenyl)methyl]benzene.
| Compound Name | 1,2,3-trimethyl-5-[(4-methylphenyl)-(3,4,5-trimethylphenyl)methyl]benzene |
|---|---|
| PubChem CID | 59749663 |
| Molecular Formula | C26H30 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1,2,3-trimethyl-5-[(4-methylphenyl)-(3,4,5-trimethylphenyl)methyl]benzene |
| SMILES | Cc1ccc(C(c2cc(C)c(C)c(C)c2)c2cc(C)c(C)c(C)c2)cc1 |
| InChI | InChI=1S/C26H30/c1-16-8-10-23(11-9-16)26(24-12-17(2)21(6)18(3)13-24)25-14-19(4)22(7)20(5)15-25/h8-15,26H,1-7H3 |
| InChIKey | JHPGHFVUSNRLPJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|