C30H30O2 — CID 146424169
5-[(3,5-dimethyl-4-prop-2-ynoxyphenyl)-(4-methylphenyl)methyl]-1,3-dimethyl-2-prop-2-ynoxybenzene (PubChem CID 146424169) has the molecular formula C30H30O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-4-prop-2-ynoxyphenyl)-(4-methylphenyl)methyl]-1,3-dimethyl-2-prop-2-ynoxybenzene.
| Compound Name | 5-[(3,5-dimethyl-4-prop-2-ynoxyphenyl)-(4-methylphenyl)methyl]-1,3-dimethyl-2-prop-2-ynoxybenzene |
|---|---|
| PubChem CID | 146424169 |
| Molecular Formula | C30H30O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 5-[(3,5-dimethyl-4-prop-2-ynoxyphenyl)-(4-methylphenyl)methyl]-1,3-dimethyl-2-prop-2-ynoxybenzene |
| SMILES | C#CCOc1c(C)cc(C(c2ccc(C)cc2)c2cc(C)c(OCC#C)c(C)c2)cc1C |
| InChI | InChI=1S/C30H30O2/c1-8-14-31-29-21(4)16-26(17-22(29)5)28(25-12-10-20(3)11-13-25)27-18-23(6)30(24(7)19-27)32-15-9-2/h1-2,10-13,16-19,28H,14-15H2,3-7H3 |
| InChIKey | RPPVAXGCVIEKFI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|