C29H30O3 — CID 21365415
2-ethenoxy-5-[(4-ethenoxy-3,5-dimethylphenyl)-(4-ethenoxyphenyl)methyl]-1,3-dimethylbenzene (PubChem CID 21365415) has the molecular formula C29H30O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-ethenoxy-5-[(4-ethenoxy-3,5-dimethylphenyl)-(4-ethenoxyphenyl)methyl]-1,3-dimethylbenzene.
| Compound Name | 2-ethenoxy-5-[(4-ethenoxy-3,5-dimethylphenyl)-(4-ethenoxyphenyl)methyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 21365415 |
| Molecular Formula | C29H30O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-ethenoxy-5-[(4-ethenoxy-3,5-dimethylphenyl)-(4-ethenoxyphenyl)methyl]-1,3-dimethylbenzene |
| SMILES | C=COc1ccc(C(c2cc(C)c(OC=C)c(C)c2)c2cc(C)c(OC=C)c(C)c2)cc1 |
| InChI | InChI=1S/C29H30O3/c1-8-30-26-13-11-23(12-14-26)27(24-15-19(4)28(31-9-2)20(5)16-24)25-17-21(6)29(32-10-3)22(7)18-25/h8-18,27H,1-3H2,4-7H3 |
| InChIKey | DFGITJXXVNUNNA-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|