C52H50O8 — CID 163521211
[4-[[4-[bis(3,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]phenyl]-(3,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]-2,6-dimethylphenyl] prop-2-enoate (PubChem CID 163521211) has the molecular formula C52H50O8 and a molecular weight of 802.96 g/mol. Its IUPAC name is [4-[[4-[bis(3,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]phenyl]-(3,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]-2,6-dimethylphenyl] prop-2-enoate.
| Compound Name | [4-[[4-[bis(3,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]phenyl]-(3,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]-2,6-dimethylphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 163521211 |
| Molecular Formula | C52H50O8 |
| Molecular Weight | 802.96 g/mol |
| Exact Mass | 802.35 |
| IUPAC Name | [4-[[4-[bis(3,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]phenyl]-(3,5-dimethyl-4-prop-2-enoyloxyphenyl)methyl]-2,6-dimethylphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C)cc(C(c2ccc(C(c3cc(C)c(OC(=O)C=C)c(C)c3)c3cc(C)c(OC(=O)C=C)c(C)c3)cc2)c2cc(C)c(OC(=O)C=C)c(C)c2)cc1C |
| InChI | InChI=1S/C52H50O8/c1-13-43(53)57-49-29(5)21-39(22-30(49)6)47(40-23-31(7)50(32(8)24-40)58-44(54)14-2)37-17-19-38(20-18-37)48(41-25-33(9)51(34(10)26-41)59-45(55)15-3)42-27-35(11)52(36(12)28-42)60-46(56)16-4/h13-28,47-48H,1-4H2,5-12H3 |
| InChIKey | DKYXQVGSGWPART-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.96 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|