C25H26O3 — CID 139751325
5-[bis(4-ethylphenyl)methyl]-2-hydroxy-3-methylbenzoic acid (PubChem CID 139751325) has the molecular formula C25H26O3 and a molecular weight of 374.48 g/mol. Its IUPAC name is 5-[bis(4-ethylphenyl)methyl]-2-hydroxy-3-methylbenzoic acid.
| Compound Name | 5-[bis(4-ethylphenyl)methyl]-2-hydroxy-3-methylbenzoic acid |
|---|---|
| PubChem CID | 139751325 |
| Molecular Formula | C25H26O3 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 5-[bis(4-ethylphenyl)methyl]-2-hydroxy-3-methylbenzoic acid |
| SMILES | CCc1ccc(C(c2ccc(CC)cc2)c2cc(C)c(O)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H26O3/c1-4-17-6-10-19(11-7-17)23(20-12-8-18(5-2)9-13-20)21-14-16(3)24(26)22(15-21)25(27)28/h6-15,23,26H,4-5H2,1-3H3,(H,27,28) |
| InChIKey | BXWRHZCYRBZDBQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|