C23H24O4 — CID 147502266
4-[(2,4-dihydroxy-3-methylphenyl)-(4-ethylphenyl)methyl]-2-methylbenzene-1,3-diol (PubChem CID 147502266) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-[(2,4-dihydroxy-3-methylphenyl)-(4-ethylphenyl)methyl]-2-methylbenzene-1,3-diol.
| Compound Name | 4-[(2,4-dihydroxy-3-methylphenyl)-(4-ethylphenyl)methyl]-2-methylbenzene-1,3-diol |
|---|---|
| PubChem CID | 147502266 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 4-[(2,4-dihydroxy-3-methylphenyl)-(4-ethylphenyl)methyl]-2-methylbenzene-1,3-diol |
| SMILES | CCc1ccc(C(c2ccc(O)c(C)c2O)c2ccc(O)c(C)c2O)cc1 |
| InChI | InChI=1S/C23H24O4/c1-4-15-5-7-16(8-6-15)21(17-9-11-19(24)13(2)22(17)26)18-10-12-20(25)14(3)23(18)27/h5-12,21,24-27H,4H2,1-3H3 |
| InChIKey | FHQKVWVPTQZELB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|