C11H16O2 — CID 14527849
2-(4-ethylphenyl)propane-1,3-diol (PubChem CID 14527849) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(4-ethylphenyl)propane-1,3-diol.
| Compound Name | 2-(4-ethylphenyl)propane-1,3-diol |
|---|---|
| PubChem CID | 14527849 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-(4-ethylphenyl)propane-1,3-diol |
| SMILES | CCc1ccc(C(CO)CO)cc1 |
| InChI | InChI=1S/C11H16O2/c1-2-9-3-5-10(6-4-9)11(7-12)8-13/h3-6,11-13H,2,7-8H2,1H3 |
| InChIKey | FMCGPXQHSCOBAF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |