C12H16Br2 — CID 23314164
1-(1,4-dibromobutan-2-yl)-4-ethylbenzene (PubChem CID 23314164) has the molecular formula C12H16Br2 and a molecular weight of 320.07 g/mol. Its IUPAC name is 1-(1,4-dibromobutan-2-yl)-4-ethylbenzene.
| Compound Name | 1-(1,4-dibromobutan-2-yl)-4-ethylbenzene |
|---|---|
| PubChem CID | 23314164 |
| Molecular Formula | C12H16Br2 |
| Molecular Weight | 320.07 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 1-(1,4-dibromobutan-2-yl)-4-ethylbenzene |
| SMILES | CCc1ccc(C(CBr)CCBr)cc1 |
| InChI | InChI=1S/C12H16Br2/c1-2-10-3-5-11(6-4-10)12(9-14)7-8-13/h3-6,12H,2,7-9H2,1H3 |
| InChIKey | LCDAQRPVXAOTAE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.07 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|