C60H50O4 — CID 139962444
4-[[4-[bis(4-hydroxy-3-methyl-5-phenylphenyl)methyl]phenyl]-(4-hydroxy-3-methyl-5-phenylphenyl)methyl]-2-methyl-6-phenylphenol (PubChem CID 139962444) has the molecular formula C60H50O4 and a molecular weight of 835.06 g/mol. Its IUPAC name is 4-[[4-[bis(4-hydroxy-3-methyl-5-phenylphenyl)methyl]phenyl]-(4-hydroxy-3-methyl-5-phenylphenyl)methyl]-2-methyl-6-phenylphenol.
| Compound Name | 4-[[4-[bis(4-hydroxy-3-methyl-5-phenylphenyl)methyl]phenyl]-(4-hydroxy-3-methyl-5-phenylphenyl)methyl]-2-methyl-6-phenylphenol |
|---|---|
| PubChem CID | 139962444 |
| Molecular Formula | C60H50O4 |
| Molecular Weight | 835.06 g/mol |
| Exact Mass | 834.37 |
| IUPAC Name | 4-[[4-[bis(4-hydroxy-3-methyl-5-phenylphenyl)methyl]phenyl]-(4-hydroxy-3-methyl-5-phenylphenyl)methyl]-2-methyl-6-phenylphenol |
| SMILES | Cc1cc(C(c2ccc(C(c3cc(C)c(O)c(-c4ccccc4)c3)c3cc(C)c(O)c(-c4ccccc4)c3)cc2)c2cc(C)c(O)c(-c3ccccc3)c2)cc(-c2ccccc2)c1O |
| InChI | InChI=1S/C60H50O4/c1-37-29-47(33-51(57(37)61)41-17-9-5-10-18-41)55(48-30-38(2)58(62)52(34-48)42-19-11-6-12-20-42)45-25-27-46(28-26-45)56(49-31-39(3)59(63)53(35-49)43-21-13-7-14-22-43)50-32-40(4)60(64)54(36-50)44-23-15-8-16-24-44/h5-36,55-56,61-64H,1-4H3 |
| InChIKey | PXRCXQARUOXOSQ-UHFFFAOYSA-N |
| XLogP | 14.77 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.06 |
| LogP ≤ 5 | 14.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|