C54H52N2O6 — CID 102145100
1-N,3-N-bis[4-[bis(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]benzene-1,3-dicarboxamide (PubChem CID 102145100) has the molecular formula C54H52N2O6 and a molecular weight of 825.02 g/mol. Its IUPAC name is 1-N,3-N-bis[4-[bis(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-[bis(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 102145100 |
| Molecular Formula | C54H52N2O6 |
| Molecular Weight | 825.02 g/mol |
| Exact Mass | 824.38 |
| IUPAC Name | 1-N,3-N-bis[4-[bis(4-hydroxy-3,5-dimethylphenyl)methyl]phenyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1cc(C(c2ccc(NC(=O)c3cccc(C(=O)Nc4ccc(C(c5cc(C)c(O)c(C)c5)c5cc(C)c(O)c(C)c5)cc4)c3)cc2)c2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C54H52N2O6/c1-29-20-41(21-30(2)49(29)57)47(42-22-31(3)50(58)32(4)23-42)37-12-16-45(17-13-37)55-53(61)39-10-9-11-40(28-39)54(62)56-46-18-14-38(15-19-46)48(43-24-33(5)51(59)34(6)25-43)44-26-35(7)52(60)36(8)27-44/h9-28,47-48,57-60H,1-8H3,(H,55,61)(H,56,62) |
| InChIKey | AKUIYSWJHJUWLB-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.02 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|