C23H24O3 — CID 22338935
2-[(2-hydroxy-4,6-dimethylphenyl)-(3-hydroxyphenyl)methyl]-3,5-dimethylphenol (PubChem CID 22338935) has the molecular formula C23H24O3 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[(2-hydroxy-4,6-dimethylphenyl)-(3-hydroxyphenyl)methyl]-3,5-dimethylphenol.
| Compound Name | 2-[(2-hydroxy-4,6-dimethylphenyl)-(3-hydroxyphenyl)methyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 22338935 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[(2-hydroxy-4,6-dimethylphenyl)-(3-hydroxyphenyl)methyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(C)c(C(c2cccc(O)c2)c2c(C)cc(C)cc2O)c(O)c1 |
| InChI | InChI=1S/C23H24O3/c1-13-8-15(3)21(19(25)10-13)23(17-6-5-7-18(24)12-17)22-16(4)9-14(2)11-20(22)26/h5-12,23-26H,1-4H3 |
| InChIKey | NFTODWFLHQDGKM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|