C16H17IO — CID 61089059
(3-iodophenyl)-(2,4,6-trimethylphenyl)methanol (PubChem CID 61089059) has the molecular formula C16H17IO and a molecular weight of 352.22 g/mol. Its IUPAC name is (3-iodophenyl)-(2,4,6-trimethylphenyl)methanol.
| Compound Name | (3-iodophenyl)-(2,4,6-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 61089059 |
| Molecular Formula | C16H17IO |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (3-iodophenyl)-(2,4,6-trimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2cccc(I)c2)c(C)c1 |
| InChI | InChI=1S/C16H17IO/c1-10-7-11(2)15(12(3)8-10)16(18)13-5-4-6-14(17)9-13/h4-9,16,18H,1-3H3 |
| InChIKey | KSZQNMAJESAMBO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|