C15H18OS — CID 65099676
(5-methylthiophen-3-yl)-(2,4,6-trimethylphenyl)methanol (PubChem CID 65099676) has the molecular formula C15H18OS and a molecular weight of 246.38 g/mol. Its IUPAC name is (5-methylthiophen-3-yl)-(2,4,6-trimethylphenyl)methanol.
| Compound Name | (5-methylthiophen-3-yl)-(2,4,6-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 65099676 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (5-methylthiophen-3-yl)-(2,4,6-trimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2csc(C)c2)c(C)c1 |
| InChI | InChI=1S/C15H18OS/c1-9-5-10(2)14(11(3)6-9)15(16)13-7-12(4)17-8-13/h5-8,15-16H,1-4H3 |
| InChIKey | KHXKLIZPEHMRSX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |