C15H18OS — CID 65099998
2-(3,5-dimethylphenyl)-1-(5-methylthiophen-3-yl)ethanol (PubChem CID 65099998) has the molecular formula C15H18OS and a molecular weight of 246.37 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-1-(5-methylthiophen-3-yl)ethanol.
| Compound Name | 2-(3,5-dimethylphenyl)-1-(5-methylthiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 65099998 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-1-(5-methylthiophen-3-yl)ethanol |
| SMILES | Cc1cc(C)cc(CC(O)c2csc(C)c2)c1 |
| InChI | InChI=1S/C15H18OS/c1-10-4-11(2)6-13(5-10)8-15(16)14-7-12(3)17-9-14/h4-7,9,15-16H,8H2,1-3H3 |
| InChIKey | GETHZEBMFXISMK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |