C15H17BrOS — CID 105084146
1-(5-bromothiophen-3-yl)-2-(2,4,6-trimethylphenyl)ethanol (PubChem CID 105084146) has the molecular formula C15H17BrOS and a molecular weight of 325.27 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-2-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 1-(5-bromothiophen-3-yl)-2-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 105084146 |
| Molecular Formula | C15H17BrOS |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-2-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(CC(O)c2csc(Br)c2)c(C)c1 |
| InChI | InChI=1S/C15H17BrOS/c1-9-4-10(2)13(11(3)5-9)7-14(17)12-6-15(16)18-8-12/h4-6,8,14,17H,7H2,1-3H3 |
| InChIKey | AAXOSUDWBRFEMH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |