C18H21BrO — CID 115781909
1-(3-bromo-5-methylphenyl)-2-(2,4,6-trimethylphenyl)ethanol (PubChem CID 115781909) has the molecular formula C18H21BrO and a molecular weight of 333.27 g/mol. Its IUPAC name is 1-(3-bromo-5-methylphenyl)-2-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 1-(3-bromo-5-methylphenyl)-2-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 115781909 |
| Molecular Formula | C18H21BrO |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-(3-bromo-5-methylphenyl)-2-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(Br)cc(C(O)Cc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C18H21BrO/c1-11-5-13(3)17(14(4)6-11)10-18(20)15-7-12(2)8-16(19)9-15/h5-9,18,20H,10H2,1-4H3 |
| InChIKey | VPQWRNTYDUYROX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |