C14H15BrOS — CID 114021555
(5-bromothiophen-3-yl)-(2,4,6-trimethylphenyl)methanol (PubChem CID 114021555) has the molecular formula C14H15BrOS and a molecular weight of 311.24 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-(2,4,6-trimethylphenyl)methanol.
| Compound Name | (5-bromothiophen-3-yl)-(2,4,6-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 114021555 |
| Molecular Formula | C14H15BrOS |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | (5-bromothiophen-3-yl)-(2,4,6-trimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2csc(Br)c2)c(C)c1 |
| InChI | InChI=1S/C14H15BrOS/c1-8-4-9(2)13(10(3)5-8)14(16)11-6-12(15)17-7-11/h4-7,14,16H,1-3H3 |
| InChIKey | ZJGJFOCQAMYACA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |