C13H12Br2OS — CID 114021565
(4-bromo-2,5-dimethylphenyl)-(5-bromothiophen-3-yl)methanol (PubChem CID 114021565) has the molecular formula C13H12Br2OS and a molecular weight of 376.11 g/mol. Its IUPAC name is (4-bromo-2,5-dimethylphenyl)-(5-bromothiophen-3-yl)methanol.
| Compound Name | (4-bromo-2,5-dimethylphenyl)-(5-bromothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 114021565 |
| Molecular Formula | C13H12Br2OS |
| Molecular Weight | 376.11 g/mol |
| Exact Mass | 373.90 |
| IUPAC Name | (4-bromo-2,5-dimethylphenyl)-(5-bromothiophen-3-yl)methanol |
| SMILES | Cc1cc(C(O)c2csc(Br)c2)c(C)cc1Br |
| InChI | InChI=1S/C13H12Br2OS/c1-7-4-11(14)8(2)3-10(7)13(16)9-5-12(15)17-6-9/h3-6,13,16H,1-2H3 |
| InChIKey | CFRNPVUPEGAGFU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.11 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |