C19H25NO — CID 43748567
3-[1-[1-(2,4,6-trimethylphenyl)ethylamino]ethyl]phenol (PubChem CID 43748567) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 3-[1-[1-(2,4,6-trimethylphenyl)ethylamino]ethyl]phenol.
| Compound Name | 3-[1-[1-(2,4,6-trimethylphenyl)ethylamino]ethyl]phenol |
|---|---|
| PubChem CID | 43748567 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 3-[1-[1-(2,4,6-trimethylphenyl)ethylamino]ethyl]phenol |
| SMILES | Cc1cc(C)c(C(C)NC(C)c2cccc(O)c2)c(C)c1 |
| InChI | InChI=1S/C19H25NO/c1-12-9-13(2)19(14(3)10-12)16(5)20-15(4)17-7-6-8-18(21)11-17/h6-11,15-16,20-21H,1-5H3 |
| InChIKey | HZYDRFYGPXTECQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |