C11H17NO — CID 130840850
2-[(1S)-1-aminopropyl]-3,5-dimethylphenol (PubChem CID 130840850) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-[(1S)-1-aminopropyl]-3,5-dimethylphenol.
| Compound Name | 2-[(1S)-1-aminopropyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 130840850 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-[(1S)-1-aminopropyl]-3,5-dimethylphenol |
| SMILES | CC[C@H](N)c1c(C)cc(C)cc1O |
| InChI | InChI=1S/C11H17NO/c1-4-9(12)11-8(3)5-7(2)6-10(11)13/h5-6,9,13H,4,12H2,1-3H3/t9-/m0/s1 |
| InChIKey | BCXQEAMIBGUEDK-VIFPVBQESA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|