C15H16FNO2 — CID 82106998
[5-(3-fluorophenyl)-2,3-dimethoxyphenyl]methanamine (PubChem CID 82106998) has the molecular formula C15H16FNO2 and a molecular weight of 261.30 g/mol. Its IUPAC name is [5-(3-fluorophenyl)-2,3-dimethoxyphenyl]methanamine.
| Compound Name | [5-(3-fluorophenyl)-2,3-dimethoxyphenyl]methanamine |
|---|---|
| PubChem CID | 82106998 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | [5-(3-fluorophenyl)-2,3-dimethoxyphenyl]methanamine |
| SMILES | COc1cc(-c2cccc(F)c2)cc(CN)c1OC |
| InChI | InChI=1S/C15H16FNO2/c1-18-14-8-11(6-12(9-17)15(14)19-2)10-4-3-5-13(16)7-10/h3-8H,9,17H2,1-2H3 |
| InChIKey | KEFZVADGBUKOPZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |