C9H18Cl3N3O — CID 23346960
3,5-bis(aminomethyl)-4-methoxyaniline;trihydrochloride (PubChem CID 23346960) has the molecular formula C9H18Cl3N3O and a molecular weight of 290.62 g/mol. Its IUPAC name is 3,5-bis(aminomethyl)-4-methoxyaniline;trihydrochloride.
| Compound Name | 3,5-bis(aminomethyl)-4-methoxyaniline;trihydrochloride |
|---|---|
| PubChem CID | 23346960 |
| Molecular Formula | C9H18Cl3N3O |
| Molecular Weight | 290.62 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 3,5-bis(aminomethyl)-4-methoxyaniline;trihydrochloride |
| SMILES | COc1c(CN)cc(N)cc1CN.Cl.Cl.Cl |
| InChI | InChI=1S/C9H15N3O.3ClH/c1-13-9-6(4-10)2-8(12)3-7(9)5-11;;;/h2-3H,4-5,10-12H2,1H3;3*1H |
| InChIKey | CVTOERDZZZWRIG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.62 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|