C11H17NO4 — CID 84791445
N-[[2,3-dimethoxy-6-(methoxymethyl)phenyl]methyl]hydroxylamine (PubChem CID 84791445) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-[[2,3-dimethoxy-6-(methoxymethyl)phenyl]methyl]hydroxylamine.
| Compound Name | N-[[2,3-dimethoxy-6-(methoxymethyl)phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 84791445 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-[[2,3-dimethoxy-6-(methoxymethyl)phenyl]methyl]hydroxylamine |
| SMILES | COCc1ccc(OC)c(OC)c1CNO |
| InChI | InChI=1S/C11H17NO4/c1-14-7-8-4-5-10(15-2)11(16-3)9(8)6-12-13/h4-5,12-13H,6-7H2,1-3H3 |
| InChIKey | MQMMWTHLNMPIKS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|