C12H18FNO2 — CID 117327075
4-(6-fluoro-2,3-dimethoxyphenyl)butan-1-amine (PubChem CID 117327075) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-(6-fluoro-2,3-dimethoxyphenyl)butan-1-amine.
| Compound Name | 4-(6-fluoro-2,3-dimethoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 117327075 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 4-(6-fluoro-2,3-dimethoxyphenyl)butan-1-amine |
| SMILES | COc1ccc(F)c(CCCCN)c1OC |
| InChI | InChI=1S/C12H18FNO2/c1-15-11-7-6-10(13)9(12(11)16-2)5-3-4-8-14/h6-7H,3-5,8,14H2,1-2H3 |
| InChIKey | SPWYUZPVKKSKCP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|