C14H23NO2 — CID 117347670
4-(2-ethyl-3,4-dimethoxyphenyl)butan-1-amine (PubChem CID 117347670) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-(2-ethyl-3,4-dimethoxyphenyl)butan-1-amine.
| Compound Name | 4-(2-ethyl-3,4-dimethoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 117347670 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-(2-ethyl-3,4-dimethoxyphenyl)butan-1-amine |
| SMILES | CCc1c(CCCCN)ccc(OC)c1OC |
| InChI | InChI=1S/C14H23NO2/c1-4-12-11(7-5-6-10-15)8-9-13(16-2)14(12)17-3/h8-9H,4-7,10,15H2,1-3H3 |
| InChIKey | CTARHTGCOKULLR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|