C30H48Cl2N2O4 — CID 14346577
(E)-N,N'-bis[2-(2-ethyl-3,4-dimethoxyphenyl)ethyl]hex-3-ene-1,6-diamine;dihydrochloride (PubChem CID 14346577) has the molecular formula C30H48Cl2N2O4 and a molecular weight of 571.63 g/mol. Its IUPAC name is (E)-N,N'-bis[2-(2-ethyl-3,4-dimethoxyphenyl)ethyl]hex-3-ene-1,6-diamine;dihydrochloride.
| Compound Name | (E)-N,N'-bis[2-(2-ethyl-3,4-dimethoxyphenyl)ethyl]hex-3-ene-1,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 14346577 |
| Molecular Formula | C30H48Cl2N2O4 |
| Molecular Weight | 571.63 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | (E)-N,N'-bis[2-(2-ethyl-3,4-dimethoxyphenyl)ethyl]hex-3-ene-1,6-diamine;dihydrochloride |
| SMILES | CCc1c(CCNCC/C=C/CCNCCc2ccc(OC)c(OC)c2CC)ccc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C30H46N2O4.2ClH/c1-7-25-23(13-15-27(33-3)29(25)35-5)17-21-31-19-11-9-10-12-20-32-22-18-24-14-16-28(34-4)30(36-6)26(24)8-2;;/h9-10,13-16,31-32H,7-8,11-12,17-22H2,1-6H3;2*1H/b10-9+;; |
| InChIKey | RQDHHYOMEGOWDZ-TTWKNDKESA-N |
| XLogP | 5.99 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|