C29H48Cl2N2O4 — CID 14346571
N,N'-bis[2-(2-ethyl-3,4-dimethoxyphenyl)ethyl]pentane-1,5-diamine;dihydrochloride (PubChem CID 14346571) has the molecular formula C29H48Cl2N2O4 and a molecular weight of 559.62 g/mol. Its IUPAC name is N,N'-bis[2-(2-ethyl-3,4-dimethoxyphenyl)ethyl]pentane-1,5-diamine;dihydrochloride.
| Compound Name | N,N'-bis[2-(2-ethyl-3,4-dimethoxyphenyl)ethyl]pentane-1,5-diamine;dihydrochloride |
|---|---|
| PubChem CID | 14346571 |
| Molecular Formula | C29H48Cl2N2O4 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | N,N'-bis[2-(2-ethyl-3,4-dimethoxyphenyl)ethyl]pentane-1,5-diamine;dihydrochloride |
| SMILES | CCc1c(CCNCCCCCNCCc2ccc(OC)c(OC)c2CC)ccc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C29H46N2O4.2ClH/c1-7-24-22(12-14-26(32-3)28(24)34-5)16-20-30-18-10-9-11-19-31-21-17-23-13-15-27(33-4)29(35-6)25(23)8-2;;/h12-15,30-31H,7-11,16-21H2,1-6H3;2*1H |
| InChIKey | GVHIPSVYGHJLLB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|