C12H18FNO2 — CID 117327192
1-(3-fluoro-2,6-dimethoxyphenyl)-2-methylpropan-2-amine (PubChem CID 117327192) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is 1-(3-fluoro-2,6-dimethoxyphenyl)-2-methylpropan-2-amine.
| Compound Name | 1-(3-fluoro-2,6-dimethoxyphenyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 117327192 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-(3-fluoro-2,6-dimethoxyphenyl)-2-methylpropan-2-amine |
| SMILES | COc1ccc(F)c(OC)c1CC(C)(C)N |
| InChI | InChI=1S/C12H18FNO2/c1-12(2,14)7-8-10(15-3)6-5-9(13)11(8)16-4/h5-6H,7,14H2,1-4H3 |
| InChIKey | UBLVRSGFRCWJJX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |