C10H14FNO3 — CID 117306476
O-[2-(5-fluoro-2,4-dimethoxyphenyl)ethyl]hydroxylamine (PubChem CID 117306476) has the molecular formula C10H14FNO3 and a molecular weight of 215.22 g/mol. Its IUPAC name is O-[2-(5-fluoro-2,4-dimethoxyphenyl)ethyl]hydroxylamine.
| Compound Name | O-[2-(5-fluoro-2,4-dimethoxyphenyl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117306476 |
| Molecular Formula | C10H14FNO3 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | O-[2-(5-fluoro-2,4-dimethoxyphenyl)ethyl]hydroxylamine |
| SMILES | COc1cc(OC)c(CCON)cc1F |
| InChI | InChI=1S/C10H14FNO3/c1-13-9-6-10(14-2)8(11)5-7(9)3-4-15-12/h5-6H,3-4,12H2,1-2H3 |
| InChIKey | PUNYDCZGIVNLJC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|