C11H15NO4 — CID 117323140
O-[2-(6-methoxy-4H-1,3-benzodioxin-7-yl)ethyl]hydroxylamine (PubChem CID 117323140) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is O-[2-(6-methoxy-4H-1,3-benzodioxin-7-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(6-methoxy-4H-1,3-benzodioxin-7-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117323140 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | O-[2-(6-methoxy-4H-1,3-benzodioxin-7-yl)ethyl]hydroxylamine |
| SMILES | COc1cc2c(cc1CCON)OCOC2 |
| InChI | InChI=1S/C11H15NO4/c1-13-10-5-9-6-14-7-15-11(9)4-8(10)2-3-16-12/h4-5H,2-3,6-7,12H2,1H3 |
| InChIKey | SULIMILJZRXWTK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|