C9H10ClNO3 — CID 117307236
O-[(6-chloro-4H-1,3-benzodioxin-7-yl)methyl]hydroxylamine (PubChem CID 117307236) has the molecular formula C9H10ClNO3 and a molecular weight of 215.64 g/mol. Its IUPAC name is O-[(6-chloro-4H-1,3-benzodioxin-7-yl)methyl]hydroxylamine.
| Compound Name | O-[(6-chloro-4H-1,3-benzodioxin-7-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117307236 |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | O-[(6-chloro-4H-1,3-benzodioxin-7-yl)methyl]hydroxylamine |
| SMILES | NOCc1cc2c(cc1Cl)COCO2 |
| InChI | InChI=1S/C9H10ClNO3/c10-8-1-7-3-12-5-13-9(7)2-6(8)4-14-11/h1-2H,3-5,11H2 |
| InChIKey | GXIYTLNIJKXAQI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|