C11H14FNO2 — CID 117301446
2-(6-fluoro-4H-1,3-benzodioxin-7-yl)propan-2-amine (PubChem CID 117301446) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-(6-fluoro-4H-1,3-benzodioxin-7-yl)propan-2-amine.
| Compound Name | 2-(6-fluoro-4H-1,3-benzodioxin-7-yl)propan-2-amine |
|---|---|
| PubChem CID | 117301446 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-(6-fluoro-4H-1,3-benzodioxin-7-yl)propan-2-amine |
| SMILES | CC(C)(N)c1cc2c(cc1F)COCO2 |
| InChI | InChI=1S/C11H14FNO2/c1-11(2,13)8-4-10-7(3-9(8)12)5-14-6-15-10/h3-4H,5-6,13H2,1-2H3 |
| InChIKey | JXZVDZBUPJMBTF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |