C9H10FNO3 — CID 117288231
N-[(6-fluoro-4H-1,3-benzodioxin-7-yl)methyl]hydroxylamine (PubChem CID 117288231) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is N-[(6-fluoro-4H-1,3-benzodioxin-7-yl)methyl]hydroxylamine.
| Compound Name | N-[(6-fluoro-4H-1,3-benzodioxin-7-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117288231 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-[(6-fluoro-4H-1,3-benzodioxin-7-yl)methyl]hydroxylamine |
| SMILES | ONCc1cc2c(cc1F)COCO2 |
| InChI | InChI=1S/C9H10FNO3/c10-8-1-7-4-13-5-14-9(7)2-6(8)3-11-12/h1-2,11-12H,3-5H2 |
| InChIKey | QEEGNNJFOQCHSA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|