C8H6Cl2O2 — CID 90695645
6,7-dichloro-4H-1,3-benzodioxine (PubChem CID 90695645) has the molecular formula C8H6Cl2O2 and a molecular weight of 205.04 g/mol. Its IUPAC name is 6,7-dichloro-4H-1,3-benzodioxine.
| Compound Name | 6,7-dichloro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 90695645 |
| Molecular Formula | C8H6Cl2O2 |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | 6,7-dichloro-4H-1,3-benzodioxine |
| SMILES | Clc1cc2c(cc1Cl)OCOC2 |
| InChI | InChI=1S/C8H6Cl2O2/c9-6-1-5-3-11-4-12-8(5)2-7(6)10/h1-2H,3-4H2 |
| InChIKey | FDTHVHWNUOUQBJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |