C11H9F2NO2 — CID 115507233
2,4-difluoro-6-(furan-2-ylmethoxy)aniline (PubChem CID 115507233) has the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. Its IUPAC name is 2,4-difluoro-6-(furan-2-ylmethoxy)aniline.
| Compound Name | 2,4-difluoro-6-(furan-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 115507233 |
| Molecular Formula | C11H9F2NO2 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2,4-difluoro-6-(furan-2-ylmethoxy)aniline |
| SMILES | Nc1c(F)cc(F)cc1OCc1ccco1 |
| InChI | InChI=1S/C11H9F2NO2/c12-7-4-9(13)11(14)10(5-7)16-6-8-2-1-3-15-8/h1-5H,6,14H2 |
| InChIKey | MRTTYUWLXOVUBO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|