C20H12F2N2O2 — CID 71812072
N-(4-cyanophenyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide (PubChem CID 71812072) has the molecular formula C20H12F2N2O2 and a molecular weight of 350.32 g/mol. Its IUPAC name is N-(4-cyanophenyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide.
| Compound Name | N-(4-cyanophenyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71812072 |
| Molecular Formula | C20H12F2N2O2 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | N-(4-cyanophenyl)-5-(2,4-difluorophenyl)-2-hydroxybenzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cc(-c3ccc(F)cc3F)ccc2O)cc1 |
| InChI | InChI=1S/C20H12F2N2O2/c21-14-4-7-16(18(22)10-14)13-3-8-19(25)17(9-13)20(26)24-15-5-1-12(11-23)2-6-15/h1-10,25H,(H,24,26) |
| InChIKey | KJFKKEXPIRFERJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |