C21H17F2N3O2S — CID 11596775
1-[[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]amino]-3-(4-methylphenyl)thiourea (PubChem CID 11596775) has the molecular formula C21H17F2N3O2S and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-[[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]amino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]amino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 11596775 |
| Molecular Formula | C21H17F2N3O2S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-[[5-(2,4-difluorophenyl)-2-hydroxybenzoyl]amino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)c2cc(-c3ccc(F)cc3F)ccc2O)cc1 |
| InChI | InChI=1S/C21H17F2N3O2S/c1-12-2-6-15(7-3-12)24-21(29)26-25-20(28)17-10-13(4-9-19(17)27)16-8-5-14(22)11-18(16)23/h2-11,27H,1H3,(H,25,28)(H2,24,26,29) |
| InChIKey | BKZFDJKQGULKEO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|