About bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine
bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine (PubChem CID 139038975) has the molecular formula C26H20N4O2
and a molecular weight of 420.47 g/mol. Its IUPAC name is bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine.
Molecular Properties
| Compound Name | bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| PubChem CID | 139038975 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine |
| SMILES | C(=C/c1ccncc1)\c1ccncc1.N#Cc1ccc(O)cc1.N#Cc1ccc(O)cc1 |
| InChI | InChI=1S/C12H10N2.2C7H5NO/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*8-5-6-1-3-7(9)4-2-6/h1-10H;2*1-4,9H/b2-1+;; |
| InChIKey | RUSBSMHYRWFXMB-SEPHDYHBSA-N |
| XLogP | 5.17 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The IUPAC name of bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine (CID 139038975) is bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine.
What is the SMILES notation for bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The canonical SMILES for bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine is C(=C/c1ccncc1)\c1ccncc1.N#Cc1ccc(O)cc1.N#Cc1ccc(O)cc1.
What is the InChIKey of bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
The InChIKey is RUSBSMHYRWFXMB-SEPHDYHBSA-N. The full InChI is InChI=1S/C12H10N2.2C7H5NO/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*8-5-6-1-3-7(9)4-2-6/h1-10H;2*1-4,9H/b2-1+;;.
What are the key properties of bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine?
bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine has a molecular weight of 420.47 g/mol, XLogP of 5.17, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxybenzonitrile);4-[(E)-2-pyridin-4-ylethenyl]pyridine is sourced from PubChem (CID 139038975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).