C16H17NOS — CID 93068855
(2R)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine (PubChem CID 93068855) has the molecular formula C16H17NOS and a molecular weight of 271.38 g/mol. Its IUPAC name is (2R)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine.
| Compound Name | (2R)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 93068855 |
| Molecular Formula | C16H17NOS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2R)-2-(3-phenylmethoxyphenyl)-1,3-thiazolidine |
| SMILES | c1ccc(COc2cccc([C@@H]3NCCS3)c2)cc1 |
| InChI | InChI=1S/C16H17NOS/c1-2-5-13(6-3-1)12-18-15-8-4-7-14(11-15)16-17-9-10-19-16/h1-8,11,16-17H,9-10,12H2/t16-/m1/s1 |
| InChIKey | SDHXREBBMPUELS-MRXNPFEDSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |