C12H15F3N2 — CID 117000351
2-[3-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 117000351) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 117000351 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | NC1CCNC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H15F3N2/c13-12(14,15)9-3-1-2-8(6-9)11-7-10(16)4-5-17-11/h1-3,6,10-11,17H,4-5,7,16H2 |
| InChIKey | QUZCIKJIXHYNFU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |